CAS 825654-54-4 appears in our catalog under these names: 2-Amino-3,6-difluorobenzoic acid, 95%, 2-Amino-3,6-difluorobenzoic acid 98%, 2-AMINO-3,6-DIFLUOROBENZOIC ACID, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-amino-3,6-difluorobenzoic acid (CAS 825654-54-4) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2-amino-3,6-difluorobenzoic acid. InChIKey: SQDLZADADYUWLA-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2-amino-3,6-difluorobenzoic acid |
| InChIKey | SQDLZADADYUWLA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)C(=O)O)N)F |
Computed by PubChem (NCBI)