Products 82572-25-6
CAS 82572-25-6 appears in our catalog under these names: L–Methionine–15N, L-METHIONINE-15N, 98 ATOM % 15N, 98% (C&, L-Methionine-15N, 98%, 98%, L-Methionine-15N, 99.50%. Offered by: GLPBio, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, 1G, 5mg, 25 mg, 100 mg, 50 mg.
(2S)-2-(15N)azanyl-4-methylsulfanylbutanoic acid (CAS 82572-25-6) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 150.21 g/mol. IUPAC name: (2S)-2-(15N)azanyl-4-methylsulfanylbutanoic acid. InChIKey: FFEARJCKVFRZRR-JGTYJTGKSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 150.21 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-4-methylsulfanylbutanoic acid |
| InChIKey | FFEARJCKVFRZRR-JGTYJTGKSA-N |
| SMILES | CSCC[C@@H](C(=O)O)[15NH2] |
Computed by PubChem (NCBI)