CAS 827012-30-6 is the registry number for 3-Chloro-4,5-dimethoxy-N-methylbenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4,5-dimethoxy-N-methylbenzamide (CAS 827012-30-6) is a chemical compound with the molecular formula C10H12ClNO3 and a molecular weight of 229.66 g/mol. IUPAC name: 3-chloro-4,5-dimethoxy-N-methylbenzamide. InChIKey: QOLCLTGTGJRHGG-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO3 |
|---|---|
| Molecular weight | 229.66 g/mol |
| IUPAC name | 3-chloro-4,5-dimethoxy-N-methylbenzamide |
| InChIKey | QOLCLTGTGJRHGG-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C(=C1)Cl)OC)OC |
Computed by PubChem (NCBI)