Products 82703-36-4
CAS 82703-36-4 is the registry number for 3,5,6,7,8,9-hexahydro-4H-Pyrimido[4,5-b]indol-4-one, 95%. Offered by: Chemat. Available pack sizes: 1g.
3,5,6,7,8,9-hexahydropyrimido[4,5-b]indol-4-one (CAS 82703-36-4) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 3,5,6,7,8,9-hexahydropyrimido[4,5-b]indol-4-one. InChIKey: YFYRDZMZTQIHLG-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 3,5,6,7,8,9-hexahydropyrimido[4,5-b]indol-4-one |
| InChIKey | YFYRDZMZTQIHLG-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N2)N=CNC3=O |
Computed by PubChem (NCBI)