CAS 827612-77-1 appears in our catalog under these names: 1-(Anilinocarbonyl)pyrrolidine-2-carboxylic acid, 1-(Anilinocarbonyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 0,5g, 5g, 250mg, 1g.
1-(phenylcarbamoyl)pyrrolidine-2-carboxylic acid (CAS 827612-77-1) is a chemical compound with the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. IUPAC name: 1-(phenylcarbamoyl)pyrrolidine-2-carboxylic acid. InChIKey: ZEEAHHXBZHTCOI-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O3 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 1-(phenylcarbamoyl)pyrrolidine-2-carboxylic acid |
| InChIKey | ZEEAHHXBZHTCOI-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)NC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)