CAS 82896-39-7 is the registry number for 4-Pyridoxic Acid-D2. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
5-[dideuterio(hydroxy)methyl]-3-hydroxy-2-methylpyridine-4-carboxylic acid (CAS 82896-39-7) is a chemical compound with the molecular formula C8H9NO4 and a molecular weight of 185.17 g/mol. IUPAC name: 5-[dideuterio(hydroxy)methyl]-3-hydroxy-2-methylpyridine-4-carboxylic acid. InChIKey: HXACOUQIXZGNBF-SMZGMGDZSA-N.
| Molecular formula | C8H9NO4 |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 5-[dideuterio(hydroxy)methyl]-3-hydroxy-2-methylpyridine-4-carboxylic acid |
| InChIKey | HXACOUQIXZGNBF-SMZGMGDZSA-N |
| SMILES | [2H]C([2H])(C1=CN=C(C(=C1C(=O)O)O)C)O |
Computed by PubChem (NCBI)