CAS 83200-96-8 is the registry number for 7-Oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-carbapenem-3-carboxylic acid is a carbapenemcarboxylic acid that is the 3-carboxy derivative of 2,3-didehydro-1-carbapenam. It is a carbapenemcarboxylic acid and an alpha,beta-unsaturated monocarboxylic acid. It is a conjugate acid of a (5R)-carbapenem-3-carboxylate.
Source: ChEBI
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | (5R)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid |
| InChIKey | BSIMZHVOQZIAOY-SCSAIBSYSA-N |
| SMILES | C1C=C(N2[C@H]1CC2=O)C(=O)O |
Computed by PubChem (NCBI)