CAS 832099-53-3 appears in our catalog under these names: 1-(propan-2-yl)-1H-1,3-benzodiazole-4-carboxylic acid, 95%, 1-Isopropyl-1H-benzo(d)imidazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-propan-2-ylbenzimidazole-4-carboxylic acid (CAS 832099-53-3) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 1-propan-2-ylbenzimidazole-4-carboxylic acid. InChIKey: STXPNSPVZQVSMN-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 1-propan-2-ylbenzimidazole-4-carboxylic acid |
| InChIKey | STXPNSPVZQVSMN-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC2=C(C=CC=C21)C(=O)O |
Computed by PubChem (NCBI)