Products 832135-73-6
CAS 832135-73-6 appears in our catalog under these names: 3-(5,7-Dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid, 95%, 3-{5,7-dimethylpyrazolo(1,5-a)pyrimidin-6-yl}propanoic acid, 95%, 3-{5,7-Dimethylpyrazolo(1,5-a)pyrimidin-6-yl}propanoic Acid. Offered by: Combi-blocks, AmBeed, TRC, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g, 100mg, 10mg, 50mg, 2,5g.
3-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid (CAS 832135-73-6) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 3-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid. InChIKey: KKNZEDKUTOBTGU-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 3-(5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid |
| InChIKey | KKNZEDKUTOBTGU-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=CC=NN12)C)CCC(=O)O |
Computed by PubChem (NCBI)