CAS 83234-67-7 is the registry number for Ethyl (S)-indoline-3-carboxylate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3S)-2,3-dihydro-1H-indole-3-carboxylate;hydrochloride (CAS 83234-67-7) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: ethyl (3S)-2,3-dihydro-1H-indole-3-carboxylate;hydrochloride. InChIKey: UTVZZTHZNFVPSH-SBSPUUFOSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | ethyl (3S)-2,3-dihydro-1H-indole-3-carboxylate;hydrochloride |
| InChIKey | UTVZZTHZNFVPSH-SBSPUUFOSA-N |
| SMILES | CCOC(=O)[C@@H]1CNC2=CC=CC=C12.Cl |
Computed by PubChem (NCBI)