CAS 832715-99-8 appears in our catalog under these names: 6–tert–butylpyridine–3–carboxylic acid, 6-(tert-Butyl)nicotinic acid, 6-(tert-Butyl)nicotinic acid, 95%, 95%, 6-(tert-Butyl)nicotinic acid, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g.
6-tert-butylpyridine-3-carboxylic acid (CAS 832715-99-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 6-tert-butylpyridine-3-carboxylic acid. InChIKey: CVGXKEVUQXTBGM-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 6-tert-butylpyridine-3-carboxylic acid |
| InChIKey | CVGXKEVUQXTBGM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)