CAS 832737-69-6 is the registry number for 5-{(4-(Methoxycarbonyl)phenoxy)methyl}furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
5-[(4-methoxycarbonylphenoxy)methyl]furan-2-carboxylic acid (CAS 832737-69-6) is a chemical compound with the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. IUPAC name: 5-[(4-methoxycarbonylphenoxy)methyl]furan-2-carboxylic acid. InChIKey: AOXJWRUSHQJOPV-UHFFFAOYSA-N.
| Molecular formula | C14H12O6 |
|---|---|
| Molecular weight | 276.24 g/mol |
| IUPAC name | 5-[(4-methoxycarbonylphenoxy)methyl]furan-2-carboxylic acid |
| InChIKey | AOXJWRUSHQJOPV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OCC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)