Products 832737-69-6

CAS 832737-69-6 is the registry number for 5-{(4-(Methoxycarbonyl)phenoxy)methyl}furan-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

5-[(4-methoxycarbonylphenoxy)methyl]furan-2-carboxylic acid (CAS 832737-69-6) is a chemical compound with the molecular formula C14H12O6 and a molecular weight of 276.24 g/mol. IUPAC name: 5-[(4-methoxycarbonylphenoxy)methyl]furan-2-carboxylic acid. InChIKey: AOXJWRUSHQJOPV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12O6
Molecular weight276.24 g/mol
IUPAC name5-[(4-methoxycarbonylphenoxy)methyl]furan-2-carboxylic acid
InChIKeyAOXJWRUSHQJOPV-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)OCC2=CC=C(O2)C(=O)O

Computed by PubChem (NCBI)