Products 832740-15-5
CAS 832740-15-5 appears in our catalog under these names: 3-isoxazol-5-ylaniline, 3–(Isoxazol–5–yl)aniline, 3-(Isoxazol-5-yl)aniline, 95%, 3-(Isoxazol-5-yl)aniline 95%, 3-(Isoxazol-5-yl)aniline, 95%, 95%. Offered by: Biosynth, GLPBio, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
3-(1,2-oxazol-5-yl)aniline (CAS 832740-15-5) is a chemical compound with the molecular formula C9H8N2O and a molecular weight of 160.17 g/mol. IUPAC name: 3-(1,2-oxazol-5-yl)aniline. InChIKey: JBFVFIPIWPLRNB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O |
|---|---|
| Molecular weight | 160.17 g/mol |
| IUPAC name | 3-(1,2-oxazol-5-yl)aniline |
| InChIKey | JBFVFIPIWPLRNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CC=NO2 |
Computed by PubChem (NCBI)