Products 832743-11-0
CAS 832743-11-0 appears in our catalog under these names: 1-Ethyl-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid, 98%, 98%, 1-Ethyl-3,6-dimethyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g.
1-ethyl-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid (CAS 832743-11-0) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: 1-ethyl-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid. InChIKey: GUOZZOGMGQZTPA-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 1-ethyl-3,6-dimethylpyrazolo[3,4-b]pyridine-4-carboxylic acid |
| InChIKey | GUOZZOGMGQZTPA-UHFFFAOYSA-N |
| SMILES | CCN1C2=NC(=CC(=C2C(=N1)C)C(=O)O)C |
Computed by PubChem (NCBI)