CAS 83277-23-0 appears in our catalog under these names: 2,4-Dichloro-3-methylbenzoic acid, 98%, 98%, 2,4-Dichloro-3-methylbenzoic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 2.5g.
2,4-dichloro-3-methylbenzoic acid (CAS 83277-23-0) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 2,4-dichloro-3-methylbenzoic acid. InChIKey: KYAATGSGTLPBHN-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 2,4-dichloro-3-methylbenzoic acid |
| InChIKey | KYAATGSGTLPBHN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)