Products 83506-93-8
CAS 83506-93-8 appears in our catalog under these names: 2–Amino–4,5–difluorobenzoic acid, 2-Amino-4,5-difluorobenzoic Acid, >98.0%(HPLC)(T), 2-Amino-4,5-difluorobenzoic acid 97%, 4,5-DIFLUOROANTHRANILIC ACID, 97%, 2-Amino-4,5-difluorobenzoic acid, 97%, 97%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 1000g, 1g, 10g, 500g, 1kg.
2-amino-4,5-difluorobenzoic acid (CAS 83506-93-8) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2-amino-4,5-difluorobenzoic acid. InChIKey: DGOZIZVTANAGCA-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2-amino-4,5-difluorobenzoic acid |
| InChIKey | DGOZIZVTANAGCA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-4,5-difluorobenzoic acid, 4,5-Difluoroanthranilic acid, Benzoic acid, 2-amino-4,5-difluoro-, 4,5-difluoro anthranilic acid, 2-amino-4,5-difluoro benzoic acid, 4,5-Difluoroanthranilic acid, 97%, Boc-ONb?, 4,5-Difluoroantranilic acid, 4,5-difluoro-2-aminobenzoic acid, 2-amino-4, 5-difluorobenzoic acid