CAS 83644-00-2 is the registry number for Rooperol. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(E)-5-(3,4-dihydroxyphenyl)pent-1-en-4-ynyl]benzene-1,2-diol (CAS 83644-00-2) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 4-[(E)-5-(3,4-dihydroxyphenyl)pent-1-en-4-ynyl]benzene-1,2-diol. InChIKey: JQPOMMNEABQHEU-DUXPYHPUSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 4-[(E)-5-(3,4-dihydroxyphenyl)pent-1-en-4-ynyl]benzene-1,2-diol |
| InChIKey | JQPOMMNEABQHEU-DUXPYHPUSA-N |
| SMILES | C1=CC(=C(C=C1/C=C/CC#CC2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)