CAS 83710-60-5 appears in our catalog under these names: 1–Bromo–8–methoxynaphthalene, 1-Bromo-8-methoxynaphthalene 95%, 1-Bromo-8-methoxynaphthalene, 95%, 95%, 1-Bromo-8-methoxynaphthalene, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
1-bromo-8-methoxynaphthalene (CAS 83710-60-5) is a chemical compound with the molecular formula C11H9BrO and a molecular weight of 237.09 g/mol. IUPAC name: 1-bromo-8-methoxynaphthalene. InChIKey: URUDGARERYTKAD-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | 1-bromo-8-methoxynaphthalene |
| InChIKey | URUDGARERYTKAD-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=CC=C2)Br |
Computed by PubChem (NCBI)