CAS 83810-57-5 is the registry number for 4,4-Dimethyl-1,2,3,4-tetrahydronaphthalen-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4,4-dimethyl-1,3-dihydronaphthalen-2-one (CAS 83810-57-5) is a chemical compound with the molecular formula C12H14O and a molecular weight of 174.24 g/mol. IUPAC name: 4,4-dimethyl-1,3-dihydronaphthalen-2-one. InChIKey: CWXUCOIJSLPOCZ-UHFFFAOYSA-N.
| Molecular formula | C12H14O |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | 4,4-dimethyl-1,3-dihydronaphthalen-2-one |
| InChIKey | CWXUCOIJSLPOCZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)CC2=CC=CC=C21)C |
Computed by PubChem (NCBI)