Products 84123-77-3
CAS 84123-77-3 is the registry number for 6-Methyl-2-(4-pyridinyl)-1H-benzimidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
6-methyl-2-pyridin-4-yl-1H-benzimidazole (CAS 84123-77-3) is a chemical compound with the molecular formula C13H11N3 and a molecular weight of 209.25 g/mol. IUPAC name: 6-methyl-2-pyridin-4-yl-1H-benzimidazole. InChIKey: VSAHWCWASCZTME-UHFFFAOYSA-N.
| Molecular formula | C13H11N3 |
|---|---|
| Molecular weight | 209.25 g/mol |
| IUPAC name | 6-methyl-2-pyridin-4-yl-1H-benzimidazole |
| InChIKey | VSAHWCWASCZTME-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)