Products 84160-41-8

CAS 84160-41-8 is the registry number for [5-(4-Methoxy-phenyl)-[1,3,4]oxadiazol-2-ylsulfanyl]-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid (CAS 84160-41-8) is a chemical compound with the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. IUPAC name: 2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid. InChIKey: ZMQTYWWCRZSQQH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O4S
Molecular weight266.28 g/mol
IUPAC name2-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetic acid
InChIKeyZMQTYWWCRZSQQH-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)C2=NN=C(O2)SCC(=O)O

Computed by PubChem (NCBI)