CAS 930111-84-5 appears in our catalog under these names: 3-Nitro-1-(toluene-4-sulfonyl)-1h-pyrrole, 95%, 3-Nitro-1-tosyl-1H-pyrrole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(4-methylphenyl)sulfonyl-3-nitropyrrole (CAS 930111-84-5) is a chemical compound with the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-3-nitropyrrole. InChIKey: PHWKAWLXYVIHMU-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4S |
|---|---|
| Molecular weight | 266.28 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-3-nitropyrrole |
| InChIKey | PHWKAWLXYVIHMU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)