Products 957063-02-4

CAS 957063-02-4 is the registry number for 1-Tosyl-1H-imidazole-4-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-(4-methylphenyl)sulfonylimidazole-4-carboxylic acid (CAS 957063-02-4) is a chemical compound with the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylimidazole-4-carboxylic acid. InChIKey: KEHGFYXOUGMVJB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N2O4S
Molecular weight266.28 g/mol
IUPAC name1-(4-methylphenyl)sulfonylimidazole-4-carboxylic acid
InChIKeyKEHGFYXOUGMVJB-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N2C=C(N=C2)C(=O)O

Computed by PubChem (NCBI)