CAS 926214-55-3 is the registry number for 2-(2-(2-Methylfuran-3-amido)-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[2-[(2-methylfuran-3-carbonyl)amino]-1,3-thiazol-4-yl]acetic acid (CAS 926214-55-3) is a chemical compound with the molecular formula C11H10N2O4S and a molecular weight of 266.28 g/mol. IUPAC name: 2-[2-[(2-methylfuran-3-carbonyl)amino]-1,3-thiazol-4-yl]acetic acid. InChIKey: NPFJVLUVGXJMQV-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O4S |
|---|---|
| Molecular weight | 266.28 g/mol |
| IUPAC name | 2-[2-[(2-methylfuran-3-carbonyl)amino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | NPFJVLUVGXJMQV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)C(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)