CAS 84174-71-0 appears in our catalog under these names: 7–Bromoquinolin–6–ol, 7-Bromoquinolin-6-ol 95%, 7-Bromoquinolin-6-ol, 95%, 95%, 7-Bromoquinolin-6-ol, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
7-bromoquinolin-6-ol (CAS 84174-71-0) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 7-bromoquinolin-6-ol. InChIKey: FJWCPOBQDFEVJT-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 7-bromoquinolin-6-ol |
| InChIKey | FJWCPOBQDFEVJT-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C(C=C2N=C1)Br)O |
Computed by PubChem (NCBI)