CAS 842136-27-0 appears in our catalog under these names: 5-Bromo-2,4-dimethylbenzoic acid, 95%, 5-Bromo-2,4-dimethylbenzoic acid, 5-Bromo-2,4-dimethylbenzoic acid 98%, 5-Bromo-2,4-dimethylbenzoic acid, 98%, 98%, 5-Bromo-2,4-dimethylbenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g, 100mg, 10g, 25g.
5-bromo-2,4-dimethylbenzoic acid (CAS 842136-27-0) is a chemical compound with the molecular formula C9H9BrO2 and a molecular weight of 229.07 g/mol. IUPAC name: 5-bromo-2,4-dimethylbenzoic acid. InChIKey: GQDYGQDSEFKPQO-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO2 |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 5-bromo-2,4-dimethylbenzoic acid |
| InChIKey | GQDYGQDSEFKPQO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)O)Br)C |
Computed by PubChem (NCBI)