Products 842972-72-9

CAS 842972-72-9 is the registry number for 2,4,5,6,7,8-Hexahydrocyclohepta[c]pyrazole-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylic acid (CAS 842972-72-9) is a chemical compound with the molecular formula C9H12N2O2 and a molecular weight of 180.20 g/mol. IUPAC name: 1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylic acid. InChIKey: NFNLJMOKEMQHAB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12N2O2
Molecular weight180.20 g/mol
IUPAC name1,4,5,6,7,8-hexahydrocyclohepta[d]pyrazole-3-carboxylic acid
InChIKeyNFNLJMOKEMQHAB-UHFFFAOYSA-N
SMILESC1CCC2=C(CC1)NN=C2C(=O)O

Computed by PubChem (NCBI)