CAS 842974-74-7 appears in our catalog under these names: 5-(3,5-Dimethyl-isoxazol-4-ylmethyl)-furan-2-carboxylic acid, 95%, 5-((3,5-Dimethylisoxazol-4-yl)methyl)furan-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]furan-2-carboxylic acid (CAS 842974-74-7) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]furan-2-carboxylic acid. InChIKey: MENMEWDWZRFWGN-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]furan-2-carboxylic acid |
| InChIKey | MENMEWDWZRFWGN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)CC2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)