CAS 84379-72-6 appears in our catalog under these names: 1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl 2,2-dimethylpropanoate, 98%, 98%, 1,3-Dioxoisoindolin-2-yl pivalate, 98%, 1,3-Dioxoisoindolin-2-yl pivalate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 100g.
(1,3-dioxoisoindol-2-yl) 2,2-dimethylpropanoate (CAS 84379-72-6) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl) 2,2-dimethylpropanoate. InChIKey: BNNGSUIJCMXEQS-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | (1,3-dioxoisoindol-2-yl) 2,2-dimethylpropanoate |
| InChIKey | BNNGSUIJCMXEQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)ON1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)