CAS 844-40-6 appears in our catalog under these names: Diphenylmethyl Trifluoroacetate, 95-<97%, Diphenylmethyl Trifluoroacetate, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g.
Benzhydryl 2,2,2-trifluoroacetate (CAS 844-40-6) is a chemical compound with the molecular formula C15H11F3O2 and a molecular weight of 280.24 g/mol. IUPAC name: benzhydryl 2,2,2-trifluoroacetate. InChIKey: GEMYQOVONCEVEQ-UHFFFAOYSA-N.
| Molecular formula | C15H11F3O2 |
|---|---|
| Molecular weight | 280.24 g/mol |
| IUPAC name | benzhydryl 2,2,2-trifluoroacetate |
| InChIKey | GEMYQOVONCEVEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)OC(=O)C(F)(F)F |
Computed by PubChem (NCBI)