CAS 84467-20-9 is the registry number for 1-(1-(4-Chlorophenyl)cyclobutyl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[1-(4-chlorophenyl)cyclobutyl]ethanone (CAS 84467-20-9) is a chemical compound with the molecular formula C12H13ClO and a molecular weight of 208.68 g/mol. IUPAC name: 1-[1-(4-chlorophenyl)cyclobutyl]ethanone. InChIKey: KJAJWYWBYJPAMX-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO |
|---|---|
| Molecular weight | 208.68 g/mol |
| IUPAC name | 1-[1-(4-chlorophenyl)cyclobutyl]ethanone |
| InChIKey | KJAJWYWBYJPAMX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1(CCC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)