Products 844885-08-1
CAS 844885-08-1 is the registry number for (3,5-Difluorophenyl)(3-methoxyphenyl)methanone, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3,5-difluorophenyl)-(3-methoxyphenyl)methanone (CAS 844885-08-1) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: (3,5-difluorophenyl)-(3-methoxyphenyl)methanone. InChIKey: XVVVWKDQMBERMO-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | (3,5-difluorophenyl)-(3-methoxyphenyl)methanone |
| InChIKey | XVVVWKDQMBERMO-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)