CAS 84491-96-3 appears in our catalog under these names: Bezafibrate Impurity 2, Bezafibrate Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-N-[2-(4-hydroxyphenyl)ethyl]benzamide (CAS 84491-96-3) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: 3-chloro-N-[2-(4-hydroxyphenyl)ethyl]benzamide. InChIKey: VRSPGPCPJBNTLG-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | 3-chloro-N-[2-(4-hydroxyphenyl)ethyl]benzamide |
| InChIKey | VRSPGPCPJBNTLG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)NCCC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)