CAS 84540-59-0 appears in our catalog under these names: 4-Methyl-3-nitrobenzyl chloride, 95%, 4-(Chloromethyl)-1-methyl-2-nitrobenzene 97%, 4-(Chloromethyl)-1-methyl-2-nitrobenzene, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 25g, 5g.
4-(chloromethyl)-1-methyl-2-nitrobenzene (CAS 84540-59-0) is a chemical compound with the molecular formula C8H8ClNO2 and a molecular weight of 185.61 g/mol. IUPAC name: 4-(chloromethyl)-1-methyl-2-nitrobenzene. InChIKey: DLTKEOYTIZIUKD-UHFFFAOYSA-N.
| Molecular formula | C8H8ClNO2 |
|---|---|
| Molecular weight | 185.61 g/mol |
| IUPAC name | 4-(chloromethyl)-1-methyl-2-nitrobenzene |
| InChIKey | DLTKEOYTIZIUKD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)