Products 845546-27-2
CAS 845546-27-2 is the registry number for 5-Oxo-1-(thiazol-2-ylmethyl)pyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-oxo-1-(1,3-thiazol-2-ylmethyl)pyrrolidine-3-carboxylic acid (CAS 845546-27-2) is a chemical compound with the molecular formula C9H10N2O3S and a molecular weight of 226.25 g/mol. IUPAC name: 5-oxo-1-(1,3-thiazol-2-ylmethyl)pyrrolidine-3-carboxylic acid. InChIKey: SHUZSNXKORKYFY-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3S |
|---|---|
| Molecular weight | 226.25 g/mol |
| IUPAC name | 5-oxo-1-(1,3-thiazol-2-ylmethyl)pyrrolidine-3-carboxylic acid |
| InChIKey | SHUZSNXKORKYFY-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)CC2=NC=CS2)C(=O)O |
Computed by PubChem (NCBI)