Products 845958-74-9
CAS 845958-74-9 appears in our catalog under these names: Methyl (3r)-3-amino-3-(3-bromophenyl)propanoate, 95%, Methyl (3R)-3-amino-3-(3-bromophenyl)propanoate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 0,5g.
Methyl (3R)-3-amino-3-(3-bromophenyl)propanoate (CAS 845958-74-9) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: methyl (3R)-3-amino-3-(3-bromophenyl)propanoate. InChIKey: AYYCGDYJGQKXIO-SECBINFHSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | methyl (3R)-3-amino-3-(3-bromophenyl)propanoate |
| InChIKey | AYYCGDYJGQKXIO-SECBINFHSA-N |
| SMILES | COC(=O)C[C@H](C1=CC(=CC=C1)Br)N |
Computed by PubChem (NCBI)