CAS 847492-00-6 appears in our catalog under these names: 3-(2-Chloro-5-fluorophenyl)propanoic acid, 95%, 95%, 3-(2-CHLORO-5-FLUORO-PHENYL)-PROPIONIC ACID, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
3-(2-chloro-5-fluorophenyl)propanoic acid (CAS 847492-00-6) is a chemical compound with the molecular formula C9H8ClFO2 and a molecular weight of 202.61 g/mol. IUPAC name: 3-(2-chloro-5-fluorophenyl)propanoic acid. InChIKey: ZUGDAQDQDCTCRF-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO2 |
|---|---|
| Molecular weight | 202.61 g/mol |
| IUPAC name | 3-(2-chloro-5-fluorophenyl)propanoic acid |
| InChIKey | ZUGDAQDQDCTCRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CCC(=O)O)Cl |
Computed by PubChem (NCBI)