Products 84771-22-2
CAS 84771-22-2 is the registry number for BOC-L-Phenylalanine-13C. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyl(113C)propanoic acid (CAS 84771-22-2) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 266.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyl(113C)propanoic acid. InChIKey: ZYJPUMXJBDHSIF-GYZZUBJBSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 266.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenyl(113C)propanoic acid |
| InChIKey | ZYJPUMXJBDHSIF-GYZZUBJBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)[13C](=O)O |
Computed by PubChem (NCBI)