CAS 87713-13-1 is the registry number for Boc-(15N)Phe-OH. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]-3-phenylpropanoic acid (CAS 87713-13-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 266.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]-3-phenylpropanoic acid. InChIKey: ZYJPUMXJBDHSIF-ATIMDCQMSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 266.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]-3-phenylpropanoic acid |
| InChIKey | ZYJPUMXJBDHSIF-ATIMDCQMSA-N |
| SMILES | CC(C)(C)OC(=O)[15NH][C@@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)