CAS 13734-34-4 appears in our catalog under these names: N-Boc-L-phenylalanine, Boc–Phe–OH, Boc-L-Phe-OH, N-Boc-L-phenylalanine, 99% , Boc-Phe-OH. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 5g, 100g, 250g, 25g, 2kg, 5kg, 10kg, 25kg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid (CAS 13734-34-4) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid. InChIKey: ZYJPUMXJBDHSIF-NSHDSACASA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid |
| InChIKey | ZYJPUMXJBDHSIF-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)