Products 84772-89-4
CAS 84772-89-4 is the registry number for 3,4-O-Isopropylidene-D-arabinonic acid δ-lactone. Offered by: Chemat. Available pack sizes: 10g, 1g, 2g, 5g.
(3aR,7S,7aS)-7-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one (CAS 84772-89-4) is a chemical compound with the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. IUPAC name: (3aR,7S,7aS)-7-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one. InChIKey: UNYKZJZFOKUHEK-NGJCXOISSA-N.
| Molecular formula | C8H12O5 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (3aR,7S,7aS)-7-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-one |
| InChIKey | UNYKZJZFOKUHEK-NGJCXOISSA-N |
| SMILES | CC1(O[C@@H]2COC(=O)[C@H]([C@@H]2O1)O)C |
Computed by PubChem (NCBI)