CAS 847729-02-6 is the registry number for (S)-tert-Butyl 4-(1-aminoethyl)benzoate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-[(1S)-1-aminoethyl]benzoate (CAS 847729-02-6) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: tert-butyl 4-[(1S)-1-aminoethyl]benzoate. InChIKey: KGWGWHWMJCDRHV-VIFPVBQESA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | tert-butyl 4-[(1S)-1-aminoethyl]benzoate |
| InChIKey | KGWGWHWMJCDRHV-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)