CAS 847782-00-7 is the registry number for 3-(1-Ethyl-5-sulfamoyl-1H-1,3-benzodiazol-2-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)propanoic acid (CAS 847782-00-7) is a chemical compound with the molecular formula C12H15N3O4S and a molecular weight of 297.33 g/mol. IUPAC name: 3-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)propanoic acid. InChIKey: IUQLTHCWGBTHMQ-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O4S |
|---|---|
| Molecular weight | 297.33 g/mol |
| IUPAC name | 3-(1-ethyl-5-sulfamoylbenzimidazol-2-yl)propanoic acid |
| InChIKey | IUQLTHCWGBTHMQ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)S(=O)(=O)N)N=C1CCC(=O)O |
Computed by PubChem (NCBI)