CAS 848027-99-6 appears in our catalog under these names: 6-(tert-Butyl)picolinic acid, 98+%, 6-tert-Butylpyridine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 100mg, 1g.
6-tert-butylpyridine-2-carboxylic acid (CAS 848027-99-6) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 6-tert-butylpyridine-2-carboxylic acid. InChIKey: RQSBFPLFUAQEDT-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 6-tert-butylpyridine-2-carboxylic acid |
| InChIKey | RQSBFPLFUAQEDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC(=N1)C(=O)O |
Computed by PubChem (NCBI)