Products 848133-87-9
CAS 848133-87-9 is the registry number for 6-Amino-4-chloro-7-ethoxy-3-quinolinecarbonitrile. Offered by: TRC. Available pack sizes: 2,5g.
6-amino-4-chloro-7-ethoxyquinoline-3-carbonitrile (CAS 848133-87-9) is a chemical compound with the molecular formula C12H10ClN3O and a molecular weight of 247.68 g/mol. IUPAC name: 6-amino-4-chloro-7-ethoxyquinoline-3-carbonitrile. InChIKey: WJPAKTRTDVKOKR-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 6-amino-4-chloro-7-ethoxyquinoline-3-carbonitrile |
| InChIKey | WJPAKTRTDVKOKR-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C(=C1)N=CC(=C2Cl)C#N)N |
Computed by PubChem (NCBI)