CAS 669092-47-1 appears in our catalog under these names: (E)-4-((4-Aminophenyl)diazenyl)-2-chlorophenol, 95%, 4-¬(4-Aminophenyl)azo|-2-chlorophenol, 95% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 1g.
4-[(4-aminophenyl)diazenyl]-2-chlorophenol (CAS 669092-47-1) is a chemical compound with the molecular formula C12H10ClN3O and a molecular weight of 247.68 g/mol. IUPAC name: 4-[(4-aminophenyl)diazenyl]-2-chlorophenol. InChIKey: YEYYEANBVVPSRQ-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 4-[(4-aminophenyl)diazenyl]-2-chlorophenol |
| InChIKey | YEYYEANBVVPSRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N=NC2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)