CAS 113282-37-4 is the registry number for Forchlorofenuron. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg.
1-(2-chloro-4-pyridinyl)-1-phenylurea (CAS 113282-37-4) is a chemical compound with the molecular formula C12H10ClN3O and a molecular weight of 247.68 g/mol. IUPAC name: 1-(2-chloro-4-pyridinyl)-1-phenylurea. InChIKey: MOKWKLMCALCWRH-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 1-(2-chloro-4-pyridinyl)-1-phenylurea |
| InChIKey | MOKWKLMCALCWRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC(=NC=C2)Cl)C(=O)N |
Computed by PubChem (NCBI)