Products 1552162-51-2
CAS 1552162-51-2 is the registry number for 2-(4-Chlorophenyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-chlorophenyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one (CAS 1552162-51-2) is a chemical compound with the molecular formula C12H10ClN3O and a molecular weight of 247.68 g/mol. IUPAC name: 2-(4-chlorophenyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one. InChIKey: SHEMYWLQNWNDMU-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazin-4-one |
| InChIKey | SHEMYWLQNWNDMU-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=N2)C3=CC=C(C=C3)Cl)C(=O)N1 |
Computed by PubChem (NCBI)