Products 1398065-87-6
CAS 1398065-87-6 appears in our catalog under these names: Forchlorfenuron-d5, >95% (HPLC), Forchlorfenuron-d5 (phenyl-d5), 99 atom % D, min 98% Chemical Purity, Forchlorfenuron-d5. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 0,05g, 0,01g, 2.5 mg, 25 mg.
1-(2-chloro-4-pyridinyl)-3-(2,3,4,5,6-pentadeuteriophenyl)urea (CAS 1398065-87-6) is a chemical compound with the molecular formula C12H10ClN3O and a molecular weight of 252.71 g/mol. IUPAC name: 1-(2-chloro-4-pyridinyl)-3-(2,3,4,5,6-pentadeuteriophenyl)urea. InChIKey: GPXLRLUVLMHHIK-RALIUCGRSA-N.
| Molecular formula | C12H10ClN3O |
|---|---|
| Molecular weight | 252.71 g/mol |
| IUPAC name | 1-(2-chloro-4-pyridinyl)-3-(2,3,4,5,6-pentadeuteriophenyl)urea |
| InChIKey | GPXLRLUVLMHHIK-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC(=O)NC2=CC(=NC=C2)Cl)[2H])[2H] |
Computed by PubChem (NCBI)