Products 848153-41-3

CAS 848153-41-3 is the registry number for 3,5-Diethyl-1-phenyl-1h-pyrazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3,5-diethyl-1-phenylpyrazole (CAS 848153-41-3) is a chemical compound with the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. IUPAC name: 3,5-diethyl-1-phenylpyrazole. InChIKey: KQEVIGIQSXKHSJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16N2
Molecular weight200.28 g/mol
IUPAC name3,5-diethyl-1-phenylpyrazole
InChIKeyKQEVIGIQSXKHSJ-UHFFFAOYSA-N
SMILESCCC1=CC(=NN1C2=CC=CC=C2)CC

Computed by PubChem (NCBI)